C7H5NO4 — CID 145079807
2,6-dihydroxy-N-oxobenzamide (PubChem CID 145079807) has the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. Its IUPAC name is 2,6-dihydroxy-N-oxobenzamide.
| Compound Name | 2,6-dihydroxy-N-oxobenzamide |
|---|---|
| PubChem CID | 145079807 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 2,6-dihydroxy-N-oxobenzamide |
| SMILES | O=NC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C7H5NO4/c9-4-2-1-3-5(10)6(4)7(11)8-12/h1-3,9-10H |
| InChIKey | UKIWDPKJYQUFOI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |