C21H31N — CID 145082650
(4R,7Z)-3-(7-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-4,6,6-trimethyl-4,5-dihydro-3H-azocine (PubChem CID 145082650) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (4R,7Z)-3-(7-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-4,6,6-trimethyl-4,5-dihydro-3H-azocine.
| Compound Name | (4R,7Z)-3-(7-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-4,6,6-trimethyl-4,5-dihydro-3H-azocine |
|---|---|
| PubChem CID | 145082650 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (4R,7Z)-3-(7-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)-4,6,6-trimethyl-4,5-dihydro-3H-azocine |
| SMILES | CCC1=CC=CC(C)(C)C=C1C1/C=N\C=C/C(C)(C)C[C@H]1C |
| InChI | InChI=1S/C21H31N/c1-7-17-9-8-10-20(3,4)14-18(17)19-15-22-12-11-21(5,6)13-16(19)2/h8-12,14-16,19H,7,13H2,1-6H3/b12-11-,22-15-/t16-,19?/m1/s1 |
| InChIKey | WRNCGOIPZCJJLJ-OWWHGWGASA-N |
| XLogP | 6.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |