C16H27N — CID 91210811
N-[(E)-2-(7-ethylcyclohept-2-en-1-yl)pent-1-enyl]ethanimine (PubChem CID 91210811) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is N-[(E)-2-(7-ethylcyclohept-2-en-1-yl)pent-1-enyl]ethanimine.
| Compound Name | N-[(E)-2-(7-ethylcyclohept-2-en-1-yl)pent-1-enyl]ethanimine |
|---|---|
| PubChem CID | 91210811 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | N-[(E)-2-(7-ethylcyclohept-2-en-1-yl)pent-1-enyl]ethanimine |
| SMILES | C/C=N/C=C(\CCC)C1C=CCCCC1CC |
| InChI | InChI=1S/C16H27N/c1-4-10-15(13-17-6-3)16-12-9-7-8-11-14(16)5-2/h6,9,12-14,16H,4-5,7-8,10-11H2,1-3H3/b15-13+,17-6+ |
| InChIKey | WJZNPMQTRWAPLQ-GKTIZVKSSA-N |
| XLogP | 5.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|