C26H39NO2 — CID 145082807
ethyl (4R)-4-[(10R,13R,17R)-3-imino-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 145082807) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is ethyl (4R)-4-[(10R,13R,17R)-3-imino-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[(10R,13R,17R)-3-imino-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 145082807 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | ethyl (4R)-4-[(10R,13R,17R)-3-imino-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | [H]/N=C1/C=C2C=CC3C(CC[C@@]4(C)C3CC[C@@H]4[C@H](C)CCC(=O)OCC)[C@@]2(C)CC1 |
| InChI | InChI=1S/C26H39NO2/c1-5-29-24(28)11-6-17(2)21-9-10-22-20-8-7-18-16-19(27)12-14-25(18,3)23(20)13-15-26(21,22)4/h7-8,16-17,20-23,27H,5-6,9-15H2,1-4H3/b27-19+/t17-,20?,21-,22?,23?,25+,26-/m1/s1 |
| InChIKey | XBODBTJTRQBULC-URHJIEMHSA-N |
| XLogP | 6.34 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|