C19H20F3N5O3 — CID 145083892
N-pyridin-2-ylformamide;2,2,2-trifluoroethyl 8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate (PubChem CID 145083892) has the molecular formula C19H20F3N5O3 and a molecular weight of 423.40 g/mol. Its IUPAC name is N-pyridin-2-ylformamide;2,2,2-trifluoroethyl 8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate.
| Compound Name | N-pyridin-2-ylformamide;2,2,2-trifluoroethyl 8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
|---|---|
| PubChem CID | 145083892 |
| Molecular Formula | C19H20F3N5O3 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-pyridin-2-ylformamide;2,2,2-trifluoroethyl 8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
| SMILES | CN1c2nc(C(=O)OCC(F)(F)F)ccc2N2CCC1C2.O=CNc1ccccn1 |
| InChI | InChI=1S/C13H14F3N3O2.C6H6N2O/c1-18-8-4-5-19(6-8)10-3-2-9(17-11(10)18)12(20)21-7-13(14,15)16;9-5-8-6-3-1-2-4-7-6/h2-3,8H,4-7H2,1H3;1-5H,(H,7,8,9) |
| InChIKey | MUFNCIAXYAHBPO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|