C17H21F3N4O — CID 145084247
acetylene;N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide;fluoroform (PubChem CID 145084247) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is acetylene;N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide;fluoroform.
| Compound Name | acetylene;N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide;fluoroform |
|---|---|
| PubChem CID | 145084247 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | acetylene;N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide;fluoroform |
| SMILES | C#C.C#C.CCNC(=O)c1ccc2c(n1)NC1CCN2C1.FC(F)F |
| InChI | InChI=1S/C12H16N4O.2C2H2.CHF3/c1-2-13-12(17)9-3-4-10-11(15-9)14-8-5-6-16(10)7-8;2*1-2;2-1(3)4/h3-4,8H,2,5-7H2,1H3,(H,13,17)(H,14,15);2*1-2H;1H |
| InChIKey | GYBQJZZULZPUAH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|