C21H23F3N4O3 — CID 145089139
2-[3-[5-[[2-(difluoromethyl)-4-pyridinyl]oxy]-2-fluorophenyl]-4-formyloxan-3-yl]-1,1-dimethylguanidine (PubChem CID 145089139) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-[3-[5-[[2-(difluoromethyl)-4-pyridinyl]oxy]-2-fluorophenyl]-4-formyloxan-3-yl]-1,1-dimethylguanidine.
| Compound Name | 2-[3-[5-[[2-(difluoromethyl)-4-pyridinyl]oxy]-2-fluorophenyl]-4-formyloxan-3-yl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 145089139 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[3-[5-[[2-(difluoromethyl)-4-pyridinyl]oxy]-2-fluorophenyl]-4-formyloxan-3-yl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N\C1(c2cc(Oc3ccnc(C(F)F)c3)ccc2F)COCCC1C=O |
| InChI | InChI=1S/C21H23F3N4O3/c1-28(2)20(25)27-21(12-30-8-6-13(21)11-29)16-9-14(3-4-17(16)22)31-15-5-7-26-18(10-15)19(23)24/h3-5,7,9-11,13,19H,6,8,12H2,1-2H3,(H2,25,27) |
| InChIKey | DERCCKKNUKDVRP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|