C15H22F2N2OS — CID 143968475
[(3S)-3-(5-amino-2-fluorophenyl)-3-(methylideneamino)oxan-4-yl]methyl thiohypofluorite;ethane (PubChem CID 143968475) has the molecular formula C15H22F2N2OS and a molecular weight of 316.42 g/mol. Its IUPAC name is [(3S)-3-(5-amino-2-fluorophenyl)-3-(methylideneamino)oxan-4-yl]methyl thiohypofluorite;ethane.
| Compound Name | [(3S)-3-(5-amino-2-fluorophenyl)-3-(methylideneamino)oxan-4-yl]methyl thiohypofluorite;ethane |
|---|---|
| PubChem CID | 143968475 |
| Molecular Formula | C15H22F2N2OS |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(3S)-3-(5-amino-2-fluorophenyl)-3-(methylideneamino)oxan-4-yl]methyl thiohypofluorite;ethane |
| SMILES | C=N[C@@]1(c2cc(N)ccc2F)COCCC1CSF.CC |
| InChI | InChI=1S/C13H16F2N2OS.C2H6/c1-17-13(8-18-5-4-9(13)7-19-15)11-6-10(16)2-3-12(11)14;1-2/h2-3,6,9H,1,4-5,7-8,16H2;1-2H3/t9?,13-;/m0./s1 |
| InChIKey | NMPGLOCTRAGEOY-LGYSWELRSA-N |
| XLogP | 3.98 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|