C11H15F3N2OS — CID 169266565
3-(3,3-difluoroazetidin-1-yl)sulfinyl-4-fluoroaniline;ethane (PubChem CID 169266565) has the molecular formula C11H15F3N2OS and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-(3,3-difluoroazetidin-1-yl)sulfinyl-4-fluoroaniline;ethane.
| Compound Name | 3-(3,3-difluoroazetidin-1-yl)sulfinyl-4-fluoroaniline;ethane |
|---|---|
| PubChem CID | 169266565 |
| Molecular Formula | C11H15F3N2OS |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-(3,3-difluoroazetidin-1-yl)sulfinyl-4-fluoroaniline;ethane |
| SMILES | CC.Nc1ccc(F)c(S(=O)N2CC(F)(F)C2)c1 |
| InChI | InChI=1S/C9H9F3N2OS.C2H6/c10-7-2-1-6(13)3-8(7)16(15)14-4-9(11,12)5-14;1-2/h1-3H,4-5,13H2;1-2H3 |
| InChIKey | RVUAYPCODWOVAW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|