C24H39N3 — CID 145090700
3-[4-ethenyl-3-(1-methylpyrazol-4-yl)phenyl]-N,N-dimethylpropan-1-amine;heptane (PubChem CID 145090700) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is 3-[4-ethenyl-3-(1-methylpyrazol-4-yl)phenyl]-N,N-dimethylpropan-1-amine;heptane.
| Compound Name | 3-[4-ethenyl-3-(1-methylpyrazol-4-yl)phenyl]-N,N-dimethylpropan-1-amine;heptane |
|---|---|
| PubChem CID | 145090700 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | 3-[4-ethenyl-3-(1-methylpyrazol-4-yl)phenyl]-N,N-dimethylpropan-1-amine;heptane |
| SMILES | C=Cc1ccc(CCCN(C)C)cc1-c1cnn(C)c1.CCCCCCC |
| InChI | InChI=1S/C17H23N3.C7H16/c1-5-15-9-8-14(7-6-10-19(2)3)11-17(15)16-12-18-20(4)13-16;1-3-5-7-6-4-2/h5,8-9,11-13H,1,6-7,10H2,2-4H3;3-7H2,1-2H3 |
| InChIKey | LDDOEGKAZCEEKO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|