C23H35N3 — CID 174197113
N-[3-(4-ethenyl-3-ethylphenyl)propyl]-N-[(5-methyl-1H-imidazol-4-yl)methyl]pentan-1-amine (PubChem CID 174197113) has the molecular formula C23H35N3 and a molecular weight of 353.55 g/mol. Its IUPAC name is N-[3-(4-ethenyl-3-ethylphenyl)propyl]-N-[(5-methyl-1H-imidazol-4-yl)methyl]pentan-1-amine.
| Compound Name | N-[3-(4-ethenyl-3-ethylphenyl)propyl]-N-[(5-methyl-1H-imidazol-4-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 174197113 |
| Molecular Formula | C23H35N3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | N-[3-(4-ethenyl-3-ethylphenyl)propyl]-N-[(5-methyl-1H-imidazol-4-yl)methyl]pentan-1-amine |
| SMILES | C=Cc1ccc(CCCN(CCCCC)Cc2nc[nH]c2C)cc1CC |
| InChI | InChI=1S/C23H35N3/c1-5-8-9-14-26(17-23-19(4)24-18-25-23)15-10-11-20-12-13-21(6-2)22(7-3)16-20/h6,12-13,16,18H,2,5,7-11,14-15,17H2,1,3-4H3,(H,24,25) |
| InChIKey | ODNKJMDFKCLAFW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|