C16H18ClN3O3S2 — CID 145095146
[(2R)-2-[[6-(hydroxyamino)-3-pyridinyl]disulfanyl]propyl] N-[4-(chloromethyl)phenyl]carbamate (PubChem CID 145095146) has the molecular formula C16H18ClN3O3S2 and a molecular weight of 399.93 g/mol. Its IUPAC name is [(2R)-2-[[6-(hydroxyamino)-3-pyridinyl]disulfanyl]propyl] N-[4-(chloromethyl)phenyl]carbamate.
| Compound Name | [(2R)-2-[[6-(hydroxyamino)-3-pyridinyl]disulfanyl]propyl] N-[4-(chloromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 145095146 |
| Molecular Formula | C16H18ClN3O3S2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [(2R)-2-[[6-(hydroxyamino)-3-pyridinyl]disulfanyl]propyl] N-[4-(chloromethyl)phenyl]carbamate |
| SMILES | C[C@H](COC(=O)Nc1ccc(CCl)cc1)SSc1ccc(NO)nc1 |
| InChI | InChI=1S/C16H18ClN3O3S2/c1-11(24-25-14-6-7-15(20-22)18-9-14)10-23-16(21)19-13-4-2-12(8-17)3-5-13/h2-7,9,11,22H,8,10H2,1H3,(H,18,20)(H,19,21)/t11-/m1/s1 |
| InChIKey | VHSFKAYTCXFHAZ-LLVKDONJSA-N |
| XLogP | 5.00 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|