C12H21N — CID 145095517
(2E)-N,2-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-amine;ethane (PubChem CID 145095517) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2E)-N,2-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-amine;ethane.
| Compound Name | (2E)-N,2-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145095517 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2E)-N,2-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-amine;ethane |
| SMILES | C#CCN(C)C/C(C)=C/C=C.CC |
| InChI | InChI=1S/C10H15N.C2H6/c1-5-7-10(3)9-11(4)8-6-2;1-2/h2,5,7H,1,8-9H2,3-4H3;1-2H3/b10-7+; |
| InChIKey | FOEUSXWRXVYDPZ-HCUGZAAXSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|