C25H32N2O2 — CID 145096350
1-(2-methoxyethoxy)propane;2-N-(4-methylphenyl)-2-N-phenylbenzene-1,2-diamine (PubChem CID 145096350) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)propane;2-N-(4-methylphenyl)-2-N-phenylbenzene-1,2-diamine.
| Compound Name | 1-(2-methoxyethoxy)propane;2-N-(4-methylphenyl)-2-N-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 145096350 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-(2-methoxyethoxy)propane;2-N-(4-methylphenyl)-2-N-phenylbenzene-1,2-diamine |
| SMILES | CCCOCCOC.Cc1ccc(N(c2ccccc2)c2ccccc2N)cc1 |
| InChI | InChI=1S/C19H18N2.C6H14O2/c1-15-11-13-17(14-12-15)21(16-7-3-2-4-8-16)19-10-6-5-9-18(19)20;1-3-4-8-6-5-7-2/h2-14H,20H2,1H3;3-6H2,1-2H3 |
| InChIKey | WOPZMALVUWFZBM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|