C21H25NO5 — CID 145100230
[(Z)-5-phenylmethoxypent-3-en-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate (PubChem CID 145100230) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [(Z)-5-phenylmethoxypent-3-en-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate.
| Compound Name | [(Z)-5-phenylmethoxypent-3-en-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 145100230 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(Z)-5-phenylmethoxypent-3-en-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate |
| SMILES | CC(/C=C\COCc1ccccc1)OC(=O)/C=C/C1=CCCC([N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H25NO5/c1-17(7-6-14-26-16-19-8-3-2-4-9-19)27-21(23)13-12-18-10-5-11-20(15-18)22(24)25/h2-4,6-10,12-13,17,20H,5,11,14-16H2,1H3/b7-6-,13-12+ |
| InChIKey | LDOPOZUXSMVSGH-NQFDUOLLSA-N |
| XLogP | 4.00 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|