About benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate
benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate (PubChem CID 20782587) has the molecular formula C20H22O4S
and a molecular weight of 358.46 g/mol. Its IUPAC name is benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate.
Molecular Properties
| Compound Name | benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate |
| PubChem CID | 20782587 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate |
| SMILES | CC(/C=C/C(=O)OCc1ccccc1)OC(=O)/C=C/C1=CCCSC1 |
| InChI | InChI=1S/C20H22O4S/c1-16(24-20(22)12-10-18-8-5-13-25-15-18)9-11-19(21)23-14-17-6-3-2-4-7-17/h2-4,6-12,16H,5,13-15H2,1H3/b11-9+,12-10+ |
| InChIKey | VDTXLRACZJOWGC-WGDLNXRISA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate?
The IUPAC name of benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate (CID 20782587) is benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate.
What is the SMILES notation for benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate?
The canonical SMILES for benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate is CC(/C=C/C(=O)OCc1ccccc1)OC(=O)/C=C/C1=CCCSC1.
What is the InChIKey of benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate?
The InChIKey is VDTXLRACZJOWGC-WGDLNXRISA-N. The full InChI is InChI=1S/C20H22O4S/c1-16(24-20(22)12-10-18-8-5-13-25-15-18)9-11-19(21)23-14-17-6-3-2-4-7-17/h2-4,6-12,16H,5,13-15H2,1H3/b11-9+,12-10+.
What are the key properties of benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate?
benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate has a molecular weight of 358.46 g/mol, XLogP of 3.84, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate is sourced from PubChem (CID 20782587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).