C20H22O4S — CID 20782587
benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate (PubChem CID 20782587) has the molecular formula C20H22O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate.
| Compound Name | benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate |
|---|---|
| PubChem CID | 20782587 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | benzyl (E)-4-[(E)-3-(3,6-dihydro-2H-thiopyran-5-yl)prop-2-enoyl]oxypent-2-enoate |
| SMILES | CC(/C=C/C(=O)OCc1ccccc1)OC(=O)/C=C/C1=CCCSC1 |
| InChI | InChI=1S/C20H22O4S/c1-16(24-20(22)12-10-18-8-5-13-25-15-18)9-11-19(21)23-14-17-6-3-2-4-7-17/h2-4,6-12,16H,5,13-15H2,1H3/b11-9+,12-10+ |
| InChIKey | VDTXLRACZJOWGC-WGDLNXRISA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|