C23H25NO6 — CID 23631010
ethyl 5-[(E)-3-oxo-3-[(2R)-5-oxo-5-phenylmethoxypent-3-yn-2-yl]oxyprop-1-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 23631010) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is ethyl 5-[(E)-3-oxo-3-[(2R)-5-oxo-5-phenylmethoxypent-3-yn-2-yl]oxyprop-1-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 5-[(E)-3-oxo-3-[(2R)-5-oxo-5-phenylmethoxypent-3-yn-2-yl]oxyprop-1-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 23631010 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | ethyl 5-[(E)-3-oxo-3-[(2R)-5-oxo-5-phenylmethoxypent-3-yn-2-yl]oxyprop-1-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC=C(/C=C/C(=O)O[C@H](C)C#CC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C23H25NO6/c1-3-28-23(27)24-15-7-10-19(16-24)12-14-22(26)30-18(2)11-13-21(25)29-17-20-8-5-4-6-9-20/h4-6,8-10,12,14,18H,3,7,15-17H2,1-2H3/b14-12+/t18-/m1/s1 |
| InChIKey | PDYWOYBCCJYHEY-QIXNEVBVSA-N |
| XLogP | 3.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|