C24H29NO6 — CID 59426502
benzyl (Z)-4-[(E)-3-[(5R)-5-(ethoxycarbonylamino)cyclohexen-1-yl]prop-2-enoyl]oxypent-2-enoate (PubChem CID 59426502) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is benzyl (Z)-4-[(E)-3-[(5R)-5-(ethoxycarbonylamino)cyclohexen-1-yl]prop-2-enoyl]oxypent-2-enoate.
| Compound Name | benzyl (Z)-4-[(E)-3-[(5R)-5-(ethoxycarbonylamino)cyclohexen-1-yl]prop-2-enoyl]oxypent-2-enoate |
|---|---|
| PubChem CID | 59426502 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | benzyl (Z)-4-[(E)-3-[(5R)-5-(ethoxycarbonylamino)cyclohexen-1-yl]prop-2-enoyl]oxypent-2-enoate |
| SMILES | CCOC(=O)N[C@@H]1CCC=C(/C=C/C(=O)OC(C)/C=C\C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C24H29NO6/c1-3-29-24(28)25-21-11-7-10-19(16-21)13-15-23(27)31-18(2)12-14-22(26)30-17-20-8-5-4-6-9-20/h4-6,8-10,12-15,18,21H,3,7,11,16-17H2,1-2H3,(H,25,28)/b14-12-,15-13+/t18?,21-/m1/s1 |
| InChIKey | SLVLABSGKFZDOW-DRGGKRIWSA-N |
| XLogP | 4.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|