C28H36O4S — CID 10838031
benzyl (E,4S)-4-(2-phenylsulfanylpropanoyloxy)dodec-2-enoate (PubChem CID 10838031) has the molecular formula C28H36O4S and a molecular weight of 468.66 g/mol. Its IUPAC name is benzyl (E,4S)-4-(2-phenylsulfanylpropanoyloxy)dodec-2-enoate.
| Compound Name | benzyl (E,4S)-4-(2-phenylsulfanylpropanoyloxy)dodec-2-enoate |
|---|---|
| PubChem CID | 10838031 |
| Molecular Formula | C28H36O4S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | benzyl (E,4S)-4-(2-phenylsulfanylpropanoyloxy)dodec-2-enoate |
| SMILES | CCCCCCCC[C@@H](/C=C/C(=O)OCc1ccccc1)OC(=O)C(C)Sc1ccccc1 |
| InChI | InChI=1S/C28H36O4S/c1-3-4-5-6-7-12-17-25(20-21-27(29)31-22-24-15-10-8-11-16-24)32-28(30)23(2)33-26-18-13-9-14-19-26/h8-11,13-16,18-21,23,25H,3-7,12,17,22H2,1-2H3/b21-20+/t23?,25-/m0/s1 |
| InChIKey | HRPNLMNSBYJIPU-VYKFCTTPSA-N |
| XLogP | 7.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|