About [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate
[(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate (PubChem CID 91379047) has the molecular formula C21H20N2O5S
and a molecular weight of 412.47 g/mol. Its IUPAC name is [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate |
| PubChem CID | 91379047 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate |
| SMILES | C[C@H](C=CC(=O)c1nc2ccccc2s1)OC(=O)C=CC1=CCCC([N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H20N2O5S/c1-14(9-11-18(24)21-22-17-7-2-3-8-19(17)29-21)28-20(25)12-10-15-5-4-6-16(13-15)23(26)27/h2-3,5,7-12,14,16H,4,6,13H2,1H3/t14-,16?/m1/s1 |
| InChIKey | JEJXUYISZZLRNG-IURRXHLWSA-N |
| XLogP | 4.28 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate?
The IUPAC name of [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate (CID 91379047) is [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate.
What is the SMILES notation for [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate?
The canonical SMILES for [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate is C[C@H](C=CC(=O)c1nc2ccccc2s1)OC(=O)C=CC1=CCCC([N+](=O)[O-])C1.
What is the InChIKey of [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate?
The InChIKey is JEJXUYISZZLRNG-IURRXHLWSA-N. The full InChI is InChI=1S/C21H20N2O5S/c1-14(9-11-18(24)21-22-17-7-2-3-8-19(17)29-21)28-20(25)12-10-15-5-4-6-16(13-15)23(26)27/h2-3,5,7-12,14,16H,4,6,13H2,1H3/t14-,16?/m1/s1.
What are the key properties of [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate?
[(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate has a molecular weight of 412.47 g/mol, XLogP of 4.28, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-5-(1,3-benzothiazol-2-yl)-5-oxopent-3-en-2-yl] 3-(5-nitrocyclohexen-1-yl)prop-2-enoate is sourced from PubChem (CID 91379047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).