C12H10BrFN2O2S — CID 145101536
(2-bromo-4-oxochromeno[3,4-d]imidazol-1-yl) thiohypofluorite;ethane (PubChem CID 145101536) has the molecular formula C12H10BrFN2O2S and a molecular weight of 345.19 g/mol. Its IUPAC name is (2-bromo-4-oxochromeno[3,4-d]imidazol-1-yl) thiohypofluorite;ethane.
| Compound Name | (2-bromo-4-oxochromeno[3,4-d]imidazol-1-yl) thiohypofluorite;ethane |
|---|---|
| PubChem CID | 145101536 |
| Molecular Formula | C12H10BrFN2O2S |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | (2-bromo-4-oxochromeno[3,4-d]imidazol-1-yl) thiohypofluorite;ethane |
| SMILES | CC.O=c1oc2ccccc2c2c1nc(Br)n2SF |
| InChI | InChI=1S/C10H4BrFN2O2S.C2H6/c11-10-13-7-8(14(10)17-12)5-3-1-2-4-6(5)16-9(7)15;1-2/h1-4H;1-2H3 |
| InChIKey | NDGPAVYCXYRCJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|