C14H21N3 — CID 145101583
(2E)-2-buta-1,3-dien-2-yl-N-methyl-1-piperazin-1-ylpenta-2,4-dien-1-imine (PubChem CID 145101583) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (2E)-2-buta-1,3-dien-2-yl-N-methyl-1-piperazin-1-ylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-2-buta-1,3-dien-2-yl-N-methyl-1-piperazin-1-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145101583 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (2E)-2-buta-1,3-dien-2-yl-N-methyl-1-piperazin-1-ylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(C(=C)C=C)/C(=N/C)N1CCNCC1 |
| InChI | InChI=1S/C14H21N3/c1-5-7-13(12(3)6-2)14(15-4)17-10-8-16-9-11-17/h5-7,16H,1-3,8-11H2,4H3/b13-7+,15-14- |
| InChIKey | LUAKZINDZRFPGZ-WMJAJJCRSA-N |
| XLogP | 1.77 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|