C19H17FN4OS — CID 145104362
N-[4-[6-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]methanimine (PubChem CID 145104362) has the molecular formula C19H17FN4OS and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[4-[6-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]methanimine.
| Compound Name | N-[4-[6-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 145104362 |
| Molecular Formula | C19H17FN4OS |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[4-[6-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]methanimine |
| SMILES | C=Nc1nc(-c2cccc(N3CCOC(c4cccc(F)c4)C3)n2)cs1 |
| InChI | InChI=1S/C19H17FN4OS/c1-21-19-23-16(12-26-19)15-6-3-7-18(22-15)24-8-9-25-17(11-24)13-4-2-5-14(20)10-13/h2-7,10,12,17H,1,8-9,11H2 |
| InChIKey | PWGBUJXMDDDXFQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|