C14H11F3N4S2 — CID 145104738
4-[2-[2-amino-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazol-2-amine (PubChem CID 145104738) has the molecular formula C14H11F3N4S2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-[2-[2-amino-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[2-amino-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104738 |
| Molecular Formula | C14H11F3N4S2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 4-[2-[2-amino-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2csc(-c3ccc(C(F)(F)F)cc3N)n2)cs1 |
| InChI | InChI=1S/C14H11F3N4S2/c1-19-13-21-11(6-23-13)10-5-22-12(20-10)8-3-2-7(4-9(8)18)14(15,16)17/h2-6H,18H2,1H3,(H,19,21) |
| InChIKey | OBOWXXJYRKUUSQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|