About 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane
3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane (PubChem CID 145106319) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane.
Molecular Properties
| Compound Name | 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane |
| PubChem CID | 145106319 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane |
| SMILES | C=C/C=N/C(=N\C)c1sccc1C(C)=O.CC |
| InChI | InChI=1S/C11H12N2OS.C2H6/c1-4-6-13-11(12-3)10-9(8(2)14)5-7-15-10;1-2/h4-7H,1H2,2-3H3;1-2H3/b12-11-,13-6+; |
| InChIKey | WUNMAPHQIUDACG-PEOMVEOESA-N |
| XLogP | 3.61 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane?
The IUPAC name of 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane (CID 145106319) is 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane.
What is the SMILES notation for 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane?
The canonical SMILES for 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane is C=C/C=N/C(=N\C)c1sccc1C(C)=O.CC.
What is the InChIKey of 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane?
The InChIKey is WUNMAPHQIUDACG-PEOMVEOESA-N. The full InChI is InChI=1S/C11H12N2OS.C2H6/c1-4-6-13-11(12-3)10-9(8(2)14)5-7-15-10;1-2/h4-7H,1H2,2-3H3;1-2H3/b12-11-,13-6+;.
What are the key properties of 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane?
3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane has a molecular weight of 250.37 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-N'-methyl-N-prop-2-enylidenethiophene-2-carboximidamide;ethane is sourced from PubChem (CID 145106319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).