C14H24FNO2 — CID 145107631
4-ethoxy-1-[2-[(3E)-2-fluoropenta-1,3-dien-3-yl]oxyethyl]piperidine (PubChem CID 145107631) has the molecular formula C14H24FNO2 and a molecular weight of 257.35 g/mol. Its IUPAC name is 4-ethoxy-1-[2-[(3E)-2-fluoropenta-1,3-dien-3-yl]oxyethyl]piperidine.
| Compound Name | 4-ethoxy-1-[2-[(3E)-2-fluoropenta-1,3-dien-3-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 145107631 |
| Molecular Formula | C14H24FNO2 |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4-ethoxy-1-[2-[(3E)-2-fluoropenta-1,3-dien-3-yl]oxyethyl]piperidine |
| SMILES | C=C(F)/C(=C\C)OCCN1CCC(OCC)CC1 |
| InChI | InChI=1S/C14H24FNO2/c1-4-14(12(3)15)18-11-10-16-8-6-13(7-9-16)17-5-2/h4,13H,3,5-11H2,1-2H3/b14-4+ |
| InChIKey | KFBJFFNSGOTCHS-LNKIKWGQSA-N |
| XLogP | 2.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|