C16H23NO8 — CID 145112106
methoxymethane;methyl 6-formyl-5-methoxy-1-(2-methoxyoxolan-3-yl)-4-oxopyridine-3-carboxylate (PubChem CID 145112106) has the molecular formula C16H23NO8 and a molecular weight of 357.36 g/mol. Its IUPAC name is methoxymethane;methyl 6-formyl-5-methoxy-1-(2-methoxyoxolan-3-yl)-4-oxopyridine-3-carboxylate.
| Compound Name | methoxymethane;methyl 6-formyl-5-methoxy-1-(2-methoxyoxolan-3-yl)-4-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 145112106 |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methoxymethane;methyl 6-formyl-5-methoxy-1-(2-methoxyoxolan-3-yl)-4-oxopyridine-3-carboxylate |
| SMILES | COC.COC(=O)c1cn(C2CCOC2OC)c(C=O)c(OC)c1=O |
| InChI | InChI=1S/C14H17NO7.C2H6O/c1-19-12-10(7-16)15(9-4-5-22-14(9)21-3)6-8(11(12)17)13(18)20-2;1-3-2/h6-7,9,14H,4-5H2,1-3H3;1-2H3 |
| InChIKey | GCDOWDXYALGGTJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 102.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|