C10H13N3 — CID 145119981
ethane;7-methylidene-1H-pyrido[2,3-d]pyrimidine (PubChem CID 145119981) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is ethane;7-methylidene-1H-pyrido[2,3-d]pyrimidine.
| Compound Name | ethane;7-methylidene-1H-pyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 145119981 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | ethane;7-methylidene-1H-pyrido[2,3-d]pyrimidine |
| SMILES | C=c1ccc2c(n1)NC=NC=2.CC |
| InChI | InChI=1S/C8H7N3.C2H6/c1-6-2-3-7-4-9-5-10-8(7)11-6;1-2/h2-5H,1H2,(H,9,10,11);1-2H3 |
| InChIKey | QHXLJLULAPFZBW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |