C16H24N3O3+ — CID 145120972
2-[2-(aminomethyl)-1-methyl-3-(oxolan-2-ylmethyl)benzimidazol-1-ium-5-yl]oxyethanol (PubChem CID 145120972) has the molecular formula C16H24N3O3+ and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-1-methyl-3-(oxolan-2-ylmethyl)benzimidazol-1-ium-5-yl]oxyethanol.
| Compound Name | 2-[2-(aminomethyl)-1-methyl-3-(oxolan-2-ylmethyl)benzimidazol-1-ium-5-yl]oxyethanol |
|---|---|
| PubChem CID | 145120972 |
| Molecular Formula | C16H24N3O3+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[2-(aminomethyl)-1-methyl-3-(oxolan-2-ylmethyl)benzimidazol-1-ium-5-yl]oxyethanol |
| SMILES | C[n+]1c(CN)n(CC2CCCO2)c2cc(OCCO)ccc21 |
| InChI | InChI=1S/C16H24N3O3/c1-18-14-5-4-12(22-8-6-20)9-15(14)19(16(18)10-17)11-13-3-2-7-21-13/h4-5,9,13,20H,2-3,6-8,10-11,17H2,1H3/q+1 |
| InChIKey | XQWLLPSUYNURHX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|