C27H35IN7O5S+ — CID 126619637
3-amino-N-[[1-ethyl-3-[[(2S)-oxolan-2-yl]methyl]-5-[2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethoxy]benzimidazol-1-ium-2-yl]methyl]-6-(iodomethyl)pyrazine-2-carboxamide (PubChem CID 126619637) has the molecular formula C27H35IN7O5S+ and a molecular weight of 696.59 g/mol. Its IUPAC name is 3-amino-N-[[1-ethyl-3-[[(2S)-oxolan-2-yl]methyl]-5-[2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethoxy]benzimidazol-1-ium-2-yl]methyl]-6-(iodomethyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[1-ethyl-3-[[(2S)-oxolan-2-yl]methyl]-5-[2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethoxy]benzimidazol-1-ium-2-yl]methyl]-6-(iodomethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126619637 |
| Molecular Formula | C27H35IN7O5S+ |
| Molecular Weight | 696.59 g/mol |
| Exact Mass | 696.15 |
| IUPAC Name | 3-amino-N-[[1-ethyl-3-[[(2S)-oxolan-2-yl]methyl]-5-[2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethoxy]benzimidazol-1-ium-2-yl]methyl]-6-(iodomethyl)pyrazine-2-carboxamide |
| SMILES | CC[n+]1c(CNC(=O)c2nc(CI)cnc2N)n(C[C@@H]2CCCO2)c2cc(OCC(=O)N3CCS(=O)CC3)ccc21 |
| InChI | InChI=1S/C27H34IN7O5S/c1-2-34-21-6-5-19(40-17-24(36)33-7-10-41(38)11-8-33)12-22(21)35(16-20-4-3-9-39-20)23(34)15-31-27(37)25-26(29)30-14-18(13-28)32-25/h5-6,12,14,20H,2-4,7-11,13,15-17H2,1H3,(H2-,29,30,31,37)/p+1/t20-/m0/s1 |
| InChIKey | LKUQVISGBOTAOU-FQEVSTJZSA-O |
| XLogP | 1.33 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|