C10H20N2S — CID 145121141
N-butyl-3-propan-2-yl-1,3-thiazolidin-2-imine (PubChem CID 145121141) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is N-butyl-3-propan-2-yl-1,3-thiazolidin-2-imine.
| Compound Name | N-butyl-3-propan-2-yl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 145121141 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-butyl-3-propan-2-yl-1,3-thiazolidin-2-imine |
| SMILES | CCCC/N=C1\SCCN1C(C)C |
| InChI | InChI=1S/C10H20N2S/c1-4-5-6-11-10-12(9(2)3)7-8-13-10/h9H,4-8H2,1-3H3/b11-10- |
| InChIKey | SGIPOJIPMSAJCF-KHPPLWFESA-N |
| XLogP | 2.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|