C29H32N2O — CID 145121585
1-[(2R,4S)-2-methyl-4-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyrrolidin-1-yl]-2,2-diphenylethanone (PubChem CID 145121585) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[(2R,4S)-2-methyl-4-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyrrolidin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[(2R,4S)-2-methyl-4-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyrrolidin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 145121585 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1-[(2R,4S)-2-methyl-4-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)pyrrolidin-1-yl]-2,2-diphenylethanone |
| SMILES | C[C@@H]1C[C@H](N2CCCCc3ccccc32)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32N2O/c1-22-20-26(30-19-11-10-13-23-12-8-9-18-27(23)30)21-31(22)29(32)28(24-14-4-2-5-15-24)25-16-6-3-7-17-25/h2-9,12,14-18,22,26,28H,10-11,13,19-21H2,1H3/t22-,26+/m1/s1 |
| InChIKey | ACUQBPVXVBIVDF-GJZUVCINSA-N |
| XLogP | 5.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |