C25H20F2P2S — CID 145124804
4-[3-fluoro-4-[3-fluoro-4-[4-methyl-3,5-bis(phosphanyl)phenyl]phenyl]phenyl]benzenethiol (PubChem CID 145124804) has the molecular formula C25H20F2P2S and a molecular weight of 452.45 g/mol. Its IUPAC name is 4-[3-fluoro-4-[3-fluoro-4-[4-methyl-3,5-bis(phosphanyl)phenyl]phenyl]phenyl]benzenethiol.
| Compound Name | 4-[3-fluoro-4-[3-fluoro-4-[4-methyl-3,5-bis(phosphanyl)phenyl]phenyl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 145124804 |
| Molecular Formula | C25H20F2P2S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 4-[3-fluoro-4-[3-fluoro-4-[4-methyl-3,5-bis(phosphanyl)phenyl]phenyl]phenyl]benzenethiol |
| SMILES | Cc1c(P)cc(-c2ccc(-c3ccc(-c4ccc(S)cc4)cc3F)cc2F)cc1P |
| InChI | InChI=1S/C25H20F2P2S/c1-14-24(28)12-18(13-25(14)29)21-9-5-17(11-23(21)27)20-8-4-16(10-22(20)26)15-2-6-19(30)7-3-15/h2-13,30H,28-29H2,1H3 |
| InChIKey | CLFAHNCAAMNLCR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|