C15H14N2 — CID 145126338
4,5-bis(ethenyl)-2-phenylpyridin-3-amine (PubChem CID 145126338) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2-phenylpyridin-3-amine.
| Compound Name | 4,5-bis(ethenyl)-2-phenylpyridin-3-amine |
|---|---|
| PubChem CID | 145126338 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4,5-bis(ethenyl)-2-phenylpyridin-3-amine |
| SMILES | C=Cc1cnc(-c2ccccc2)c(N)c1C=C |
| InChI | InChI=1S/C15H14N2/c1-3-11-10-17-15(14(16)13(11)4-2)12-8-6-5-7-9-12/h3-10H,1-2,16H2 |
| InChIKey | FWYNYKAALUERDE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |