C15H23N4O3S+ — CID 145126509
2-[2-[[(4E)-4-(pyridine-4-carbonylhydrazinylidene)pentanoyl]amino]ethylsulfanyl]ethyloxidanium (PubChem CID 145126509) has the molecular formula C15H23N4O3S+ and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[2-[[(4E)-4-(pyridine-4-carbonylhydrazinylidene)pentanoyl]amino]ethylsulfanyl]ethyloxidanium.
| Compound Name | 2-[2-[[(4E)-4-(pyridine-4-carbonylhydrazinylidene)pentanoyl]amino]ethylsulfanyl]ethyloxidanium |
|---|---|
| PubChem CID | 145126509 |
| Molecular Formula | C15H23N4O3S+ |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[2-[[(4E)-4-(pyridine-4-carbonylhydrazinylidene)pentanoyl]amino]ethylsulfanyl]ethyloxidanium |
| SMILES | C/C(CCC(=O)NCCSCC[OH2+])=N\NC(=O)c1ccncc1 |
| InChI | InChI=1S/C15H22N4O3S/c1-12(2-3-14(21)17-8-10-23-11-9-20)18-19-15(22)13-4-6-16-7-5-13/h4-7,20H,2-3,8-11H2,1H3,(H,17,21)(H,19,22)/p+1/b18-12+ |
| InChIKey | PUUSYDMWBCZDOB-LDADJPATSA-O |
| XLogP | 0.54 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|