About 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol
4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol (PubChem CID 145131579) has the molecular formula C10H21F2NO3
and a molecular weight of 241.28 g/mol. Its IUPAC name is 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol |
| PubChem CID | 145131579 |
| Molecular Formula | C10H21F2NO3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.ON1CCC(OC(F)F)CC1 |
| InChI | InChI=1S/C6H11F2NO2.C4H10O/c7-6(8)11-5-1-3-9(10)4-2-5;1-4(2,3)5/h5-6,10H,1-4H2;5H,1-3H3 |
| InChIKey | REHLSLYOZXLZSL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol?
The IUPAC name of 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol (CID 145131579) is 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol.
What is the SMILES notation for 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol?
The canonical SMILES for 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol is CC(C)(C)O.ON1CCC(OC(F)F)CC1.
What is the InChIKey of 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol?
The InChIKey is REHLSLYOZXLZSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO2.C4H10O/c7-6(8)11-5-1-3-9(10)4-2-5;1-4(2,3)5/h5-6,10H,1-4H2;5H,1-3H3.
What are the key properties of 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol?
4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol has a molecular weight of 241.28 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-1-hydroxypiperidine;2-methylpropan-2-ol is sourced from PubChem (CID 145131579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).