About 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol
1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol (PubChem CID 167511279) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol |
| PubChem CID | 167511279 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CC1CCN(O)CC1 |
| InChI | InChI=1S/C6H13NO.C4H10O/c1-6-2-4-7(8)5-3-6;1-4(2,3)5/h6,8H,2-5H2,1H3;5H,1-3H3 |
| InChIKey | VKCMFNOARYUYBW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol?
The IUPAC name of 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol (CID 167511279) is 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol.
What is the SMILES notation for 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol?
The canonical SMILES for 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol is CC(C)(C)O.CC1CCN(O)CC1.
What is the InChIKey of 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol?
The InChIKey is VKCMFNOARYUYBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C4H10O/c1-6-2-4-7(8)5-3-6;1-4(2,3)5/h6,8H,2-5H2,1H3;5H,1-3H3.
What are the key properties of 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol?
1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol has a molecular weight of 189.30 g/mol, XLogP of 1.88, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-4-methylpiperidine;2-methylpropan-2-ol is sourced from PubChem (CID 167511279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).