C14H26N4O — CID 145132749
2,5,5,7,7-pentamethyl-8-(2H-tetrazol-5-yl)octan-3-one (PubChem CID 145132749) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 2,5,5,7,7-pentamethyl-8-(2H-tetrazol-5-yl)octan-3-one.
| Compound Name | 2,5,5,7,7-pentamethyl-8-(2H-tetrazol-5-yl)octan-3-one |
|---|---|
| PubChem CID | 145132749 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2,5,5,7,7-pentamethyl-8-(2H-tetrazol-5-yl)octan-3-one |
| SMILES | CC(C)C(=O)CC(C)(C)CC(C)(C)Cc1nn[nH]n1 |
| InChI | InChI=1S/C14H26N4O/c1-10(2)11(19)7-13(3,4)9-14(5,6)8-12-15-17-18-16-12/h10H,7-9H2,1-6H3,(H,15,16,17,18) |
| InChIKey | IWIGAUMSTMIUHP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |