C14H17N3O2 — CID 145142471
1-(6-ethenyl-4-nitro-1H-indol-3-yl)butan-2-amine (PubChem CID 145142471) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(6-ethenyl-4-nitro-1H-indol-3-yl)butan-2-amine.
| Compound Name | 1-(6-ethenyl-4-nitro-1H-indol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 145142471 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-(6-ethenyl-4-nitro-1H-indol-3-yl)butan-2-amine |
| SMILES | C=Cc1cc([N+](=O)[O-])c2c(CC(N)CC)c[nH]c2c1 |
| InChI | InChI=1S/C14H17N3O2/c1-3-9-5-12-14(13(6-9)17(18)19)10(8-16-12)7-11(15)4-2/h3,5-6,8,11,16H,1,4,7,15H2,2H3 |
| InChIKey | BYMNTJUOISJWNF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|