C16H20N2O — CID 145142533
3-amino-4-(5-ethynyl-1H-indol-3-yl)but-1-en-2-ol;ethane (PubChem CID 145142533) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-amino-4-(5-ethynyl-1H-indol-3-yl)but-1-en-2-ol;ethane.
| Compound Name | 3-amino-4-(5-ethynyl-1H-indol-3-yl)but-1-en-2-ol;ethane |
|---|---|
| PubChem CID | 145142533 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-amino-4-(5-ethynyl-1H-indol-3-yl)but-1-en-2-ol;ethane |
| SMILES | C#Cc1ccc2[nH]cc(CC(N)C(=C)O)c2c1.CC |
| InChI | InChI=1S/C14H14N2O.C2H6/c1-3-10-4-5-14-12(6-10)11(8-16-14)7-13(15)9(2)17;1-2/h1,4-6,8,13,16-17H,2,7,15H2;1-2H3 |
| InChIKey | XFPQCNJACNEGQM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|