C25H29ClFNO — CID 145145069
(3E,4E,6E)-6-chloro-3-ethylidene-4-ethynylocta-1,4,6-triene;N-[(Z)-1-(4-fluorophenoxy)but-2-en-2-yl]propan-2-imine (PubChem CID 145145069) has the molecular formula C25H29ClFNO and a molecular weight of 413.96 g/mol. Its IUPAC name is (3E,4E,6E)-6-chloro-3-ethylidene-4-ethynylocta-1,4,6-triene;N-[(Z)-1-(4-fluorophenoxy)but-2-en-2-yl]propan-2-imine.
| Compound Name | (3E,4E,6E)-6-chloro-3-ethylidene-4-ethynylocta-1,4,6-triene;N-[(Z)-1-(4-fluorophenoxy)but-2-en-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 145145069 |
| Molecular Formula | C25H29ClFNO |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (3E,4E,6E)-6-chloro-3-ethylidene-4-ethynylocta-1,4,6-triene;N-[(Z)-1-(4-fluorophenoxy)but-2-en-2-yl]propan-2-imine |
| SMILES | C#CC(=C\C(Cl)=C/C)/C(C=C)=C/C.C/C=C(/COc1ccc(F)cc1)N=C(C)C |
| InChI | InChI=1S/C13H16FNO.C12H13Cl/c1-4-12(15-10(2)3)9-16-13-7-5-11(14)6-8-13;1-5-10(6-2)11(7-3)9-12(13)8-4/h4-8H,9H2,1-3H3;3,5-6,8-9H,1H2,2,4H3/b12-4-;10-6+,11-9+,12-8+ |
| InChIKey | HYJQYWDZMDITPX-JZXFMYESSA-N |
| XLogP | 7.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|