C12H19N — CID 145149489
ethane;N-[(1Z)-2-ethenyl-3-methylidenepenta-1,4-dienyl]ethanimine (PubChem CID 145149489) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;N-[(1Z)-2-ethenyl-3-methylidenepenta-1,4-dienyl]ethanimine.
| Compound Name | ethane;N-[(1Z)-2-ethenyl-3-methylidenepenta-1,4-dienyl]ethanimine |
|---|---|
| PubChem CID | 145149489 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;N-[(1Z)-2-ethenyl-3-methylidenepenta-1,4-dienyl]ethanimine |
| SMILES | C=CC(=C)C(C=C)=C/N=C/C.CC |
| InChI | InChI=1S/C10H13N.C2H6/c1-5-9(4)10(6-2)8-11-7-3;1-2/h5-8H,1-2,4H2,3H3;1-2H3/b10-8-,11-7+; |
| InChIKey | DOJTYCCGEWEQIK-PHNBQTRWSA-N |
| XLogP | 3.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|