C8H13NO2 — CID 145152798
(E)-2-(C,N-dimethylcarbonimidoyl)pent-2-enoic acid (PubChem CID 145152798) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (E)-2-(C,N-dimethylcarbonimidoyl)pent-2-enoic acid.
| Compound Name | (E)-2-(C,N-dimethylcarbonimidoyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 145152798 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (E)-2-(C,N-dimethylcarbonimidoyl)pent-2-enoic acid |
| SMILES | CC/C=C(C(=O)O)\C(C)=N\C |
| InChI | InChI=1S/C8H13NO2/c1-4-5-7(8(10)11)6(2)9-3/h5H,4H2,1-3H3,(H,10,11)/b7-5+,9-6+ |
| InChIKey | WDRQIJIXHWHEFW-PDTNFJSOSA-N |
| XLogP | 1.50 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|