C7H9F2NO2 — CID 155718657
(E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid (PubChem CID 155718657) has the molecular formula C7H9F2NO2 and a molecular weight of 177.15 g/mol. Its IUPAC name is (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid.
| Compound Name | (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid |
|---|---|
| PubChem CID | 155718657 |
| Molecular Formula | C7H9F2NO2 |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (E)-5,5-difluoro-2-methyl-4-methyliminopent-2-enoic acid |
| SMILES | C/N=C(/C=C(\C)C(=O)O)C(F)F |
| InChI | InChI=1S/C7H9F2NO2/c1-4(7(11)12)3-5(10-2)6(8)9/h3,6H,1-2H3,(H,11,12)/b4-3+,10-5- |
| InChIKey | NDOWFMGMEBRJMB-STMOGGTPSA-N |
| XLogP | 1.35 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|