C34H64O — CID 145154047
2-methylpropane;propane;5-(3,7,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-1-en-2-ol (PubChem CID 145154047) has the molecular formula C34H64O and a molecular weight of 488.89 g/mol. Its IUPAC name is 2-methylpropane;propane;5-(3,7,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-1-en-2-ol.
| Compound Name | 2-methylpropane;propane;5-(3,7,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-1-en-2-ol |
|---|---|
| PubChem CID | 145154047 |
| Molecular Formula | C34H64O |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.50 |
| IUPAC Name | 2-methylpropane;propane;5-(3,7,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hex-1-en-2-ol |
| SMILES | C=C(O)CCC(C)C1CCC2C3C(C)CC4CC(C)CCC4(C)C3CCC12C.CC(C)C.CCC |
| InChI | InChI=1S/C27H46O.C4H10.C3H8/c1-17-11-13-26(5)21(15-17)16-19(3)25-23-10-9-22(18(2)7-8-20(4)28)27(23,6)14-12-24(25)26;1-4(2)3;1-3-2/h17-19,21-25,28H,4,7-16H2,1-3,5-6H3;4H,1-3H3;3H2,1-2H3 |
| InChIKey | RTGSWRGQBPTGLN-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|