C35H56N2O — CID 145155124
2-[[3-[[(4E,5Z)-4-ethylidene-2,6-dimethylocta-5,7-dien-3-ylidene]amino]-4-methylphenyl]methylamino]-3-methylbut-3-en-1-ol;5-ethyloct-1-ene (PubChem CID 145155124) has the molecular formula C35H56N2O and a molecular weight of 520.85 g/mol. Its IUPAC name is 2-[[3-[[(4E,5Z)-4-ethylidene-2,6-dimethylocta-5,7-dien-3-ylidene]amino]-4-methylphenyl]methylamino]-3-methylbut-3-en-1-ol;5-ethyloct-1-ene.
| Compound Name | 2-[[3-[[(4E,5Z)-4-ethylidene-2,6-dimethylocta-5,7-dien-3-ylidene]amino]-4-methylphenyl]methylamino]-3-methylbut-3-en-1-ol;5-ethyloct-1-ene |
|---|---|
| PubChem CID | 145155124 |
| Molecular Formula | C35H56N2O |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.44 |
| IUPAC Name | 2-[[3-[[(4E,5Z)-4-ethylidene-2,6-dimethylocta-5,7-dien-3-ylidene]amino]-4-methylphenyl]methylamino]-3-methylbut-3-en-1-ol;5-ethyloct-1-ene |
| SMILES | C=C/C(C)=C\C(=C/C)\C(=N\c1cc(CNC(CO)C(=C)C)ccc1C)C(C)C.C=CCCC(CC)CCC |
| InChI | InChI=1S/C25H36N2O.C10H20/c1-9-19(7)13-22(10-2)25(18(5)6)27-23-14-21(12-11-20(23)8)15-26-24(16-28)17(3)4;1-4-7-9-10(6-3)8-5-2/h9-14,18,24,26,28H,1,3,15-16H2,2,4-8H3;4,10H,1,5-9H2,2-3H3/b19-13-,22-10+,27-25+; |
| InChIKey | HWJJPRXWWJIXEM-UVBRBRFFSA-N |
| XLogP | 9.61 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|