About 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene
2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene (PubChem CID 145156596) has the molecular formula C14H14N2O7
and a molecular weight of 322.27 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene |
| PubChem CID | 145156596 |
| Molecular Formula | C14H14N2O7 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene |
| SMILES | COc1ccc([N+](=O)[O-])cc1.O=COCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H7NO4.C7H7NO3/c9-5-12-4-3-8-6(10)1-2-7(8)11;1-11-7-4-2-6(3-5-7)8(9)10/h1-2,5H,3-4H2;2-5H,1H3 |
| InChIKey | MRQLJARLDNUJGU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene (CID 145156596) is 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene is COc1ccc([N+](=O)[O-])cc1.O=COCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene?
The InChIKey is MRQLJARLDNUJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4.C7H7NO3/c9-5-12-4-3-8-6(10)1-2-7(8)11;1-11-7-4-2-6(3-5-7)8(9)10/h1-2,5H,3-4H2;2-5H,1H3.
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene?
2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene has a molecular weight of 322.27 g/mol, XLogP of 0.69, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)ethyl formate;1-methoxy-4-nitrobenzene is sourced from PubChem (CID 145156596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).