C24H24N4 — CID 145157602
3-(2,5-dimethylphenyl)-12-(6-methyl-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 145157602) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-12-(6-methyl-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 3-(2,5-dimethylphenyl)-12-(6-methyl-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 145157602 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-12-(6-methyl-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | Cc1ccc(C)c(N2CCCc3nc4ccc(-c5ccc(C)nc5)cn4c32)c1 |
| InChI | InChI=1S/C24H24N4/c1-16-6-7-17(2)22(13-16)27-12-4-5-21-24(27)28-15-20(10-11-23(28)26-21)19-9-8-18(3)25-14-19/h6-11,13-15H,4-5,12H2,1-3H3 |
| InChIKey | YDCUKVIMDGBKHV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |