C18H37NO2 — CID 145159350
N-(5-hydroxypentyl)formamide;1,1,3-trimethyl-4-propan-2-ylcyclohexane (PubChem CID 145159350) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is N-(5-hydroxypentyl)formamide;1,1,3-trimethyl-4-propan-2-ylcyclohexane.
| Compound Name | N-(5-hydroxypentyl)formamide;1,1,3-trimethyl-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 145159350 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | N-(5-hydroxypentyl)formamide;1,1,3-trimethyl-4-propan-2-ylcyclohexane |
| SMILES | CC(C)C1CCC(C)(C)CC1C.O=CNCCCCCO |
| InChI | InChI=1S/C12H24.C6H13NO2/c1-9(2)11-6-7-12(4,5)8-10(11)3;8-5-3-1-2-4-7-6-9/h9-11H,6-8H2,1-5H3;6,8H,1-5H2,(H,7,9) |
| InChIKey | PJYHOQISGAYQDF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|