C13H22N2 — CID 145160547
4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2-trimethylpiperazine (PubChem CID 145160547) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2-trimethylpiperazine.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2-trimethylpiperazine |
|---|---|
| PubChem CID | 145160547 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2,2-trimethylpiperazine |
| SMILES | C=C/C=C(\C=C)N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H22N2/c1-6-8-12(7-2)15-10-9-14(5)13(3,4)11-15/h6-8H,1-2,9-11H2,3-5H3/b12-8+ |
| InChIKey | YHAMACCGLKJPDX-XYOKQWHBSA-N |
| XLogP | 2.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|